C24H37N2O2Y+ — CID 159372449
2-[3-(2-cyclopentylacetyl)-1-ethylpiperidin-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide;yttrium (PubChem CID 159372449) has the molecular formula C24H37N2O2Y+ and a molecular weight of 474.48 g/mol. Its IUPAC name is 2-[3-(2-cyclopentylacetyl)-1-ethylpiperidin-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide;yttrium.
| Compound Name | 2-[3-(2-cyclopentylacetyl)-1-ethylpiperidin-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide;yttrium |
|---|---|
| PubChem CID | 159372449 |
| Molecular Formula | C24H37N2O2Y+ |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 2-[3-(2-cyclopentylacetyl)-1-ethylpiperidin-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide;yttrium |
| SMILES | CC[N+]1(CC(=O)Nc2c(C)cccc2C)CCCC(C(=O)CC2CCCC2)C1.[Y] |
| InChI | InChI=1S/C24H36N2O2.Y/c1-4-26(17-23(28)25-24-18(2)9-7-10-19(24)3)14-8-13-21(16-26)22(27)15-20-11-5-6-12-20;/h7,9-10,20-21H,4-6,8,11-17H2,1-3H3;/p+1 |
| InChIKey | ACRAAZGNFXXEJF-UHFFFAOYSA-O |
| XLogP | 4.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|