C21H34N3O2Y+ — CID 159634516
1-[2-(2,6-dimethylanilino)-2-oxoethyl]-1-ethyl-N-propylpiperidin-1-ium-3-carboxamide;yttrium (PubChem CID 159634516) has the molecular formula C21H34N3O2Y+ and a molecular weight of 449.43 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylanilino)-2-oxoethyl]-1-ethyl-N-propylpiperidin-1-ium-3-carboxamide;yttrium.
| Compound Name | 1-[2-(2,6-dimethylanilino)-2-oxoethyl]-1-ethyl-N-propylpiperidin-1-ium-3-carboxamide;yttrium |
|---|---|
| PubChem CID | 159634516 |
| Molecular Formula | C21H34N3O2Y+ |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 1-[2-(2,6-dimethylanilino)-2-oxoethyl]-1-ethyl-N-propylpiperidin-1-ium-3-carboxamide;yttrium |
| SMILES | CCCNC(=O)C1CCC[N+](CC)(CC(=O)Nc2c(C)cccc2C)C1.[Y] |
| InChI | InChI=1S/C21H33N3O2.Y/c1-5-12-22-21(26)18-11-8-13-24(6-2,14-18)15-19(25)23-20-16(3)9-7-10-17(20)4;/h7,9-10,18H,5-6,8,11-15H2,1-4H3,(H-,22,23,25,26);/p+1 |
| InChIKey | FXZAKKOMSIMGTP-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|