C22H36N3O2Y+ — CID 162138502
1-[2-(2,6-dimethylanilino)-2-oxoethyl]-N,N,1-triethylpiperidin-1-ium-3-carboxamide;yttrium (PubChem CID 162138502) has the molecular formula C22H36N3O2Y+ and a molecular weight of 463.46 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylanilino)-2-oxoethyl]-N,N,1-triethylpiperidin-1-ium-3-carboxamide;yttrium.
| Compound Name | 1-[2-(2,6-dimethylanilino)-2-oxoethyl]-N,N,1-triethylpiperidin-1-ium-3-carboxamide;yttrium |
|---|---|
| PubChem CID | 162138502 |
| Molecular Formula | C22H36N3O2Y+ |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 1-[2-(2,6-dimethylanilino)-2-oxoethyl]-N,N,1-triethylpiperidin-1-ium-3-carboxamide;yttrium |
| SMILES | CCN(CC)C(=O)C1CCC[N+](CC)(CC(=O)Nc2c(C)cccc2C)C1.[Y] |
| InChI | InChI=1S/C22H35N3O2.Y/c1-6-24(7-2)22(27)19-13-10-14-25(8-3,15-19)16-20(26)23-21-17(4)11-9-12-18(21)5;/h9,11-12,19H,6-8,10,13-16H2,1-5H3;/p+1 |
| InChIKey | RITYAOPLSOVSDU-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|