C26H36N3O2+ — CID 155615652
2-[1-[2-(dimethylamino)-2-oxoethyl]-4-phenylazepan-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 155615652) has the molecular formula C26H36N3O2+ and a molecular weight of 422.59 g/mol. Its IUPAC name is 2-[1-[2-(dimethylamino)-2-oxoethyl]-4-phenylazepan-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[1-[2-(dimethylamino)-2-oxoethyl]-4-phenylazepan-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 155615652 |
| Molecular Formula | C26H36N3O2+ |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 2-[1-[2-(dimethylamino)-2-oxoethyl]-4-phenylazepan-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)C[N+]1(CC(=O)N(C)C)CCCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H35N3O2/c1-20-10-8-11-21(2)26(20)27-24(30)18-29(19-25(31)28(3)4)16-9-14-23(15-17-29)22-12-6-5-7-13-22/h5-8,10-13,23H,9,14-19H2,1-4H3/p+1 |
| InChIKey | PGNQYOUUENPNIE-UHFFFAOYSA-O |
| XLogP | 4.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|