C25H35N2+ — CID 176531230
N-[1-(1-ethyl-3-phenylpiperidin-1-ium-1-yl)buta-2,3-dien-2-yl]-2,6-dimethylaniline;molecular hydrogen (PubChem CID 176531230) has the molecular formula C25H35N2+ and a molecular weight of 363.57 g/mol. Its IUPAC name is N-[1-(1-ethyl-3-phenylpiperidin-1-ium-1-yl)buta-2,3-dien-2-yl]-2,6-dimethylaniline;molecular hydrogen.
| Compound Name | N-[1-(1-ethyl-3-phenylpiperidin-1-ium-1-yl)buta-2,3-dien-2-yl]-2,6-dimethylaniline;molecular hydrogen |
|---|---|
| PubChem CID | 176531230 |
| Molecular Formula | C25H35N2+ |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | N-[1-(1-ethyl-3-phenylpiperidin-1-ium-1-yl)buta-2,3-dien-2-yl]-2,6-dimethylaniline;molecular hydrogen |
| SMILES | C=C=C(C[N+]1(CC)CCCC(c2ccccc2)C1)Nc1c(C)cccc1C.[H][H] |
| InChI | InChI=1S/C25H33N2.H2/c1-5-24(26-25-20(3)12-10-13-21(25)4)19-27(6-2)17-11-16-23(18-27)22-14-8-7-9-15-22;/h7-10,12-15,23,26H,1,6,11,16-19H2,2-4H3;1H/q+1; |
| InChIKey | LRUKSQMYAZROOV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|