C24H33N2O+ — CID 155615643
N-(2,6-dimethylphenyl)-2-(1-ethyl-3-phenylpiperidin-1-ium-1-yl)propanamide (PubChem CID 155615643) has the molecular formula C24H33N2O+ and a molecular weight of 365.54 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-(1-ethyl-3-phenylpiperidin-1-ium-1-yl)propanamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-(1-ethyl-3-phenylpiperidin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 155615643 |
| Molecular Formula | C24H33N2O+ |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-(1-ethyl-3-phenylpiperidin-1-ium-1-yl)propanamide |
| SMILES | CC[N+]1(C(C)C(=O)Nc2c(C)cccc2C)CCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C24H32N2O/c1-5-26(16-10-15-22(17-26)21-13-7-6-8-14-21)20(4)24(27)25-23-18(2)11-9-12-19(23)3/h6-9,11-14,20,22H,5,10,15-17H2,1-4H3/p+1 |
| InChIKey | JVMDDWGMQJUNLG-UHFFFAOYSA-O |
| XLogP | 5.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|