C24H32N3O4+ — CID 155115219
methyl 2-[[2-[1-(2-amino-2-hydroxyethyl)-3-phenylpiperidin-1-ium-1-yl]acetyl]amino]-3-methylbenzoate (PubChem CID 155115219) has the molecular formula C24H32N3O4+ and a molecular weight of 426.54 g/mol. Its IUPAC name is methyl 2-[[2-[1-(2-amino-2-hydroxyethyl)-3-phenylpiperidin-1-ium-1-yl]acetyl]amino]-3-methylbenzoate.
| Compound Name | methyl 2-[[2-[1-(2-amino-2-hydroxyethyl)-3-phenylpiperidin-1-ium-1-yl]acetyl]amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 155115219 |
| Molecular Formula | C24H32N3O4+ |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | methyl 2-[[2-[1-(2-amino-2-hydroxyethyl)-3-phenylpiperidin-1-ium-1-yl]acetyl]amino]-3-methylbenzoate |
| SMILES | COC(=O)c1cccc(C)c1NC(=O)C[N+]1(CC(N)O)CCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C24H31N3O4/c1-17-8-6-12-20(24(30)31-2)23(17)26-22(29)16-27(15-21(25)28)13-7-11-19(14-27)18-9-4-3-5-10-18/h3-6,8-10,12,19,21,28H,7,11,13-16,25H2,1-2H3/p+1 |
| InChIKey | WGLUKRGQXHTHFR-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|