C26H31NO3 — CID 155115308
methyl 3-methyl-2-[3-(5-phenyl-1-bicyclo[5.1.0]octanyl)propanoylamino]benzoate (PubChem CID 155115308) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is methyl 3-methyl-2-[3-(5-phenyl-1-bicyclo[5.1.0]octanyl)propanoylamino]benzoate.
| Compound Name | methyl 3-methyl-2-[3-(5-phenyl-1-bicyclo[5.1.0]octanyl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 155115308 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | methyl 3-methyl-2-[3-(5-phenyl-1-bicyclo[5.1.0]octanyl)propanoylamino]benzoate |
| SMILES | COC(=O)c1cccc(C)c1NC(=O)CCC12CCCC(c3ccccc3)CC1C2 |
| InChI | InChI=1S/C26H31NO3/c1-18-8-6-12-22(25(29)30-2)24(18)27-23(28)13-15-26-14-7-11-20(16-21(26)17-26)19-9-4-3-5-10-19/h3-6,8-10,12,20-21H,7,11,13-17H2,1-2H3,(H,27,28) |
| InChIKey | UWINBZHKVIAZGA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |