C30H40N3O4+ — CID 170269983
methyl 2-[[2-[1-benzyl-3-(cyclohexylcarbamoyl)piperidin-1-ium-1-yl]acetyl]amino]-3-methylbenzoate (PubChem CID 170269983) has the molecular formula C30H40N3O4+ and a molecular weight of 506.67 g/mol. Its IUPAC name is methyl 2-[[2-[1-benzyl-3-(cyclohexylcarbamoyl)piperidin-1-ium-1-yl]acetyl]amino]-3-methylbenzoate.
| Compound Name | methyl 2-[[2-[1-benzyl-3-(cyclohexylcarbamoyl)piperidin-1-ium-1-yl]acetyl]amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 170269983 |
| Molecular Formula | C30H40N3O4+ |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | methyl 2-[[2-[1-benzyl-3-(cyclohexylcarbamoyl)piperidin-1-ium-1-yl]acetyl]amino]-3-methylbenzoate |
| SMILES | COC(=O)c1cccc(C)c1NC(=O)C[N+]1(Cc2ccccc2)CCCC(C(=O)NC2CCCCC2)C1 |
| InChI | InChI=1S/C30H39N3O4/c1-22-11-9-17-26(30(36)37-2)28(22)32-27(34)21-33(19-23-12-5-3-6-13-23)18-10-14-24(20-33)29(35)31-25-15-7-4-8-16-25/h3,5-6,9,11-13,17,24-25H,4,7-8,10,14-16,18-21H2,1-2H3,(H-,31,32,34,35,36)/p+1 |
| InChIKey | CQHJVDSYRULJEH-UHFFFAOYSA-O |
| XLogP | 4.60 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|