C30H38F3N3O4 — CID 159532342
2-[1-benzyl-3-(piperidine-1-carbonyl)piperidin-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide;2,2,2-trifluoroacetate (PubChem CID 159532342) has the molecular formula C30H38F3N3O4 and a molecular weight of 561.65 g/mol. Its IUPAC name is 2-[1-benzyl-3-(piperidine-1-carbonyl)piperidin-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide;2,2,2-trifluoroacetate.
| Compound Name | 2-[1-benzyl-3-(piperidine-1-carbonyl)piperidin-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 159532342 |
| Molecular Formula | C30H38F3N3O4 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | 2-[1-benzyl-3-(piperidine-1-carbonyl)piperidin-1-ium-1-yl]-N-(2,6-dimethylphenyl)acetamide;2,2,2-trifluoroacetate |
| SMILES | Cc1cccc(C)c1NC(=O)C[N+]1(Cc2ccccc2)CCCC(C(=O)N2CCCCC2)C1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C28H37N3O2.C2HF3O2/c1-22-11-9-12-23(2)27(22)29-26(32)21-31(19-24-13-5-3-6-14-24)18-10-15-25(20-31)28(33)30-16-7-4-8-17-30;3-2(4,5)1(6)7/h3,5-6,9,11-14,25H,4,7-8,10,15-21H2,1-2H3;(H,6,7) |
| InChIKey | LIYDBQNZECEFPL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|