C25H33BrN2O3 — CID 155100276
[1-benzyl-1-[2-(2,6-dimethylanilino)-2-oxoethyl]piperidin-1-ium-3-yl] propanoate bromide (PubChem CID 155100276) has the molecular formula C25H33BrN2O3 and a molecular weight of 489.45 g/mol. Its IUPAC name is [1-benzyl-1-[2-(2,6-dimethylanilino)-2-oxoethyl]piperidin-1-ium-3-yl] propanoate bromide.
| Compound Name | [1-benzyl-1-[2-(2,6-dimethylanilino)-2-oxoethyl]piperidin-1-ium-3-yl] propanoate bromide |
|---|---|
| PubChem CID | 155100276 |
| Molecular Formula | C25H33BrN2O3 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [1-benzyl-1-[2-(2,6-dimethylanilino)-2-oxoethyl]piperidin-1-ium-3-yl] propanoate bromide |
| SMILES | CCC(=O)OC1CCC[N+](CC(=O)Nc2c(C)cccc2C)(Cc2ccccc2)C1.[Br-] |
| InChI | InChI=1S/C25H32N2O3.BrH/c1-4-24(29)30-22-14-9-15-27(17-22,16-21-12-6-5-7-13-21)18-23(28)26-25-19(2)10-8-11-20(25)3;/h5-8,10-13,22H,4,9,14-18H2,1-3H3;1H |
| InChIKey | XXZBDDXQVRGVLI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|