C23H28N3O+ — CID 168813709
2-(1-benzylazepan-1-ium-1-yl)-N-(2-cyano-6-methylphenyl)acetamide (PubChem CID 168813709) has the molecular formula C23H28N3O+ and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-(1-benzylazepan-1-ium-1-yl)-N-(2-cyano-6-methylphenyl)acetamide.
| Compound Name | 2-(1-benzylazepan-1-ium-1-yl)-N-(2-cyano-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 168813709 |
| Molecular Formula | C23H28N3O+ |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-(1-benzylazepan-1-ium-1-yl)-N-(2-cyano-6-methylphenyl)acetamide |
| SMILES | Cc1cccc(C#N)c1NC(=O)C[N+]1(Cc2ccccc2)CCCCCC1 |
| InChI | InChI=1S/C23H27N3O/c1-19-10-9-13-21(16-24)23(19)25-22(27)18-26(14-7-2-3-8-15-26)17-20-11-5-4-6-12-20/h4-6,9-13H,2-3,7-8,14-15,17-18H2,1H3/p+1 |
| InChIKey | LKIRHTXYDZDTKL-UHFFFAOYSA-O |
| XLogP | 4.40 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|