C24H31N2O3+ — CID 155100287
methyl 3-[[1-[2-(2,6-dimethylanilino)-2-oxoethyl]piperidin-1-ium-1-yl]methyl]benzoate (PubChem CID 155100287) has the molecular formula C24H31N2O3+ and a molecular weight of 395.52 g/mol. Its IUPAC name is methyl 3-[[1-[2-(2,6-dimethylanilino)-2-oxoethyl]piperidin-1-ium-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[1-[2-(2,6-dimethylanilino)-2-oxoethyl]piperidin-1-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 155100287 |
| Molecular Formula | C24H31N2O3+ |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | methyl 3-[[1-[2-(2,6-dimethylanilino)-2-oxoethyl]piperidin-1-ium-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(C[N+]2(CC(=O)Nc3c(C)cccc3C)CCCCC2)c1 |
| InChI | InChI=1S/C24H30N2O3/c1-18-9-7-10-19(2)23(18)25-22(27)17-26(13-5-4-6-14-26)16-20-11-8-12-21(15-20)24(28)29-3/h7-12,15H,4-6,13-14,16-17H2,1-3H3/p+1 |
| InChIKey | WRFDSTMSXRSLFR-UHFFFAOYSA-O |
| XLogP | 4.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|