C30H39N2O5+ — CID 155615585
cyclohexyl 1-benzyl-1-[2-(2-methoxycarbonyl-6-methylanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate (PubChem CID 155615585) has the molecular formula C30H39N2O5+ and a molecular weight of 507.65 g/mol. Its IUPAC name is cyclohexyl 1-benzyl-1-[2-(2-methoxycarbonyl-6-methylanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate.
| Compound Name | cyclohexyl 1-benzyl-1-[2-(2-methoxycarbonyl-6-methylanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 155615585 |
| Molecular Formula | C30H39N2O5+ |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | cyclohexyl 1-benzyl-1-[2-(2-methoxycarbonyl-6-methylanilino)-2-oxoethyl]piperidin-1-ium-3-carboxylate |
| SMILES | COC(=O)c1cccc(C)c1NC(=O)C[N+]1(Cc2ccccc2)CCCC(C(=O)OC2CCCCC2)C1 |
| InChI | InChI=1S/C30H38N2O5/c1-22-11-9-17-26(30(35)36-2)28(22)31-27(33)21-32(19-23-12-5-3-6-13-23)18-10-14-24(20-32)29(34)37-25-15-7-4-8-16-25/h3,5-6,9,11-13,17,24-25H,4,7-8,10,14-16,18-21H2,1-2H3/p+1 |
| InChIKey | DUHFAGOIRCRTLK-UHFFFAOYSA-O |
| XLogP | 5.02 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|