C27H38BrN3O2 — CID 157157083
1-benzyl-1-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-(2-methylpropyl)piperidin-1-ium-3-carboxamide bromide (PubChem CID 157157083) has the molecular formula C27H38BrN3O2 and a molecular weight of 516.52 g/mol. Its IUPAC name is 1-benzyl-1-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-(2-methylpropyl)piperidin-1-ium-3-carboxamide bromide.
| Compound Name | 1-benzyl-1-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-(2-methylpropyl)piperidin-1-ium-3-carboxamide bromide |
|---|---|
| PubChem CID | 157157083 |
| Molecular Formula | C27H38BrN3O2 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 1-benzyl-1-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-(2-methylpropyl)piperidin-1-ium-3-carboxamide bromide |
| SMILES | Cc1cccc(C)c1NC(=O)C[N+]1(Cc2ccccc2)CCCC(C(=O)NCC(C)C)C1.[Br-] |
| InChI | InChI=1S/C27H37N3O2.BrH/c1-20(2)16-28-27(32)24-14-9-15-30(18-24,17-23-12-6-5-7-13-23)19-25(31)29-26-21(3)10-8-11-22(26)4;/h5-8,10-13,20,24H,9,14-19H2,1-4H3,(H-,28,29,31,32);1H |
| InChIKey | FJCPVFWRXFGPOO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|