C22H29N2O+ — CID 155614995
2-(1-benzylpyrrolidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 155614995) has the molecular formula C22H29N2O+ and a molecular weight of 337.49 g/mol. Its IUPAC name is 2-(1-benzylpyrrolidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-(1-benzylpyrrolidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 155614995 |
| Molecular Formula | C22H29N2O+ |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 2-(1-benzylpyrrolidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)C[N+]2(Cc3ccccc3)CCCC2)c(C)c1 |
| InChI | InChI=1S/C22H28N2O/c1-17-13-18(2)22(19(3)14-17)23-21(25)16-24(11-7-8-12-24)15-20-9-5-4-6-10-20/h4-6,9-10,13-14H,7-8,11-12,15-16H2,1-3H3/p+1 |
| InChIKey | SMSUKPBCZVADPO-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|