C20H31N2O3+ — CID 157440072
methyl 2-[[2-(1-ethylazepan-1-ium-1-yl)acetyl]amino]-3,5-dimethylbenzoate (PubChem CID 157440072) has the molecular formula C20H31N2O3+ and a molecular weight of 347.48 g/mol. Its IUPAC name is methyl 2-[[2-(1-ethylazepan-1-ium-1-yl)acetyl]amino]-3,5-dimethylbenzoate.
| Compound Name | methyl 2-[[2-(1-ethylazepan-1-ium-1-yl)acetyl]amino]-3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 157440072 |
| Molecular Formula | C20H31N2O3+ |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | methyl 2-[[2-(1-ethylazepan-1-ium-1-yl)acetyl]amino]-3,5-dimethylbenzoate |
| SMILES | CC[N+]1(CC(=O)Nc2c(C)cc(C)cc2C(=O)OC)CCCCCC1 |
| InChI | InChI=1S/C20H30N2O3/c1-5-22(10-8-6-7-9-11-22)14-18(23)21-19-16(3)12-15(2)13-17(19)20(24)25-4/h12-13H,5-11,14H2,1-4H3/p+1 |
| InChIKey | CVVYAUPONJSNMP-UHFFFAOYSA-O |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|