C18H27N2O4+ — CID 158369787
methyl 2-[[2-(1-ethylpyrrolidin-1-ium-1-yl)acetyl]amino]-5-methoxy-3-methylbenzoate (PubChem CID 158369787) has the molecular formula C18H27N2O4+ and a molecular weight of 335.42 g/mol. Its IUPAC name is methyl 2-[[2-(1-ethylpyrrolidin-1-ium-1-yl)acetyl]amino]-5-methoxy-3-methylbenzoate.
| Compound Name | methyl 2-[[2-(1-ethylpyrrolidin-1-ium-1-yl)acetyl]amino]-5-methoxy-3-methylbenzoate |
|---|---|
| PubChem CID | 158369787 |
| Molecular Formula | C18H27N2O4+ |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | methyl 2-[[2-(1-ethylpyrrolidin-1-ium-1-yl)acetyl]amino]-5-methoxy-3-methylbenzoate |
| SMILES | CC[N+]1(CC(=O)Nc2c(C)cc(OC)cc2C(=O)OC)CCCC1 |
| InChI | InChI=1S/C18H26N2O4/c1-5-20(8-6-7-9-20)12-16(21)19-17-13(2)10-14(23-3)11-15(17)18(22)24-4/h10-11H,5-9,12H2,1-4H3/p+1 |
| InChIKey | IPDZPEFPOQNCQO-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|