C21H30N3O3+ — CID 160989261
ethyl 2-[[2-(1-ethylazepan-1-ium-1-yl)acetyl]amino]-5-isocyano-3-methylbenzoate (PubChem CID 160989261) has the molecular formula C21H30N3O3+ and a molecular weight of 372.49 g/mol. Its IUPAC name is ethyl 2-[[2-(1-ethylazepan-1-ium-1-yl)acetyl]amino]-5-isocyano-3-methylbenzoate.
| Compound Name | ethyl 2-[[2-(1-ethylazepan-1-ium-1-yl)acetyl]amino]-5-isocyano-3-methylbenzoate |
|---|---|
| PubChem CID | 160989261 |
| Molecular Formula | C21H30N3O3+ |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | ethyl 2-[[2-(1-ethylazepan-1-ium-1-yl)acetyl]amino]-5-isocyano-3-methylbenzoate |
| SMILES | [C-]#[N+]c1cc(C)c(NC(=O)C[N+]2(CC)CCCCCC2)c(C(=O)OCC)c1 |
| InChI | InChI=1S/C21H29N3O3/c1-5-24(11-9-7-8-10-12-24)15-19(25)23-20-16(3)13-17(22-4)14-18(20)21(26)27-6-2/h13-14H,5-12,15H2,1-3H3/p+1 |
| InChIKey | XSAIOKOZAKFOSP-UHFFFAOYSA-O |
| XLogP | 4.07 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|