C21H28N3O3+ — CID 157152484
methyl 2-[[1-(1-ethylpiperidin-1-ium-1-yl)cyclopropanecarbonyl]amino]-5-isocyano-3-methylbenzoate (PubChem CID 157152484) has the molecular formula C21H28N3O3+ and a molecular weight of 370.47 g/mol. Its IUPAC name is methyl 2-[[1-(1-ethylpiperidin-1-ium-1-yl)cyclopropanecarbonyl]amino]-5-isocyano-3-methylbenzoate.
| Compound Name | methyl 2-[[1-(1-ethylpiperidin-1-ium-1-yl)cyclopropanecarbonyl]amino]-5-isocyano-3-methylbenzoate |
|---|---|
| PubChem CID | 157152484 |
| Molecular Formula | C21H28N3O3+ |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | methyl 2-[[1-(1-ethylpiperidin-1-ium-1-yl)cyclopropanecarbonyl]amino]-5-isocyano-3-methylbenzoate |
| SMILES | [C-]#[N+]c1cc(C)c(NC(=O)C2([N+]3(CC)CCCCC3)CC2)c(C(=O)OC)c1 |
| InChI | InChI=1S/C21H27N3O3/c1-5-24(11-7-6-8-12-24)21(9-10-21)20(26)23-18-15(2)13-16(22-3)14-17(18)19(25)27-4/h13-14H,5-12H2,1-2,4H3/p+1 |
| InChIKey | OQGRRKHQPYEPIJ-UHFFFAOYSA-O |
| XLogP | 3.82 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|