C22H32N3OY+ — CID 158253564
1-(1-ethylazepan-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)cyclobutane-1-carboxamide;yttrium (PubChem CID 158253564) has the molecular formula C22H32N3OY+ and a molecular weight of 443.42 g/mol. Its IUPAC name is 1-(1-ethylazepan-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)cyclobutane-1-carboxamide;yttrium.
| Compound Name | 1-(1-ethylazepan-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)cyclobutane-1-carboxamide;yttrium |
|---|---|
| PubChem CID | 158253564 |
| Molecular Formula | C22H32N3OY+ |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 1-(1-ethylazepan-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)cyclobutane-1-carboxamide;yttrium |
| SMILES | [C-]#[N+]c1cc(C)c(NC(=O)C2([N+]3(CC)CCCCCC3)CCC2)c(C)c1.[Y] |
| InChI | InChI=1S/C22H31N3O.Y/c1-5-25(13-8-6-7-9-14-25)22(11-10-12-22)21(26)24-20-17(2)15-19(23-4)16-18(20)3;/h15-16H,5-14H2,1-3H3;/p+1 |
| InChIKey | NUOTUEWOVXHDCT-UHFFFAOYSA-O |
| XLogP | 5.12 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|