C20H28N3O+ — CID 159733317
1-(1-ethylpiperidin-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)cyclopropane-1-carboxamide (PubChem CID 159733317) has the molecular formula C20H28N3O+ and a molecular weight of 326.46 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(1-ethylpiperidin-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 159733317 |
| Molecular Formula | C20H28N3O+ |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 1-(1-ethylpiperidin-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)cyclopropane-1-carboxamide |
| SMILES | [C-]#[N+]c1cc(C)c(NC(=O)C2([N+]3(CC)CCCCC3)CC2)c(C)c1 |
| InChI | InChI=1S/C20H27N3O/c1-5-23(11-7-6-8-12-23)20(9-10-20)19(24)22-18-15(2)13-17(21-4)14-16(18)3/h13-14H,5-12H2,1-3H3/p+1 |
| InChIKey | KPTHQUVPQSOACY-UHFFFAOYSA-O |
| XLogP | 4.35 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|