C21H33N2O+ — CID 160848987
1-(1-ethylazepan-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)cyclopropane-1-carboxamide (PubChem CID 160848987) has the molecular formula C21H33N2O+ and a molecular weight of 329.51 g/mol. Its IUPAC name is 1-(1-ethylazepan-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(1-ethylazepan-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 160848987 |
| Molecular Formula | C21H33N2O+ |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | 1-(1-ethylazepan-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)cyclopropane-1-carboxamide |
| SMILES | CC[N+]1(C2(C(=O)Nc3c(C)cc(C)cc3C)CC2)CCCCCC1 |
| InChI | InChI=1S/C21H32N2O/c1-5-23(12-8-6-7-9-13-23)21(10-11-21)20(24)22-19-17(3)14-16(2)15-18(19)4/h14-15H,5-13H2,1-4H3/p+1 |
| InChIKey | SPVZSBKBVHDTAL-UHFFFAOYSA-O |
| XLogP | 4.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|