C21H30ClN2O3+ — CID 158469422
ethyl 5-chloro-2-[[1-(1-ethylpyrrolidin-1-ium-1-yl)cyclobutanecarbonyl]amino]-3-methylbenzoate (PubChem CID 158469422) has the molecular formula C21H30ClN2O3+ and a molecular weight of 393.94 g/mol. Its IUPAC name is ethyl 5-chloro-2-[[1-(1-ethylpyrrolidin-1-ium-1-yl)cyclobutanecarbonyl]amino]-3-methylbenzoate.
| Compound Name | ethyl 5-chloro-2-[[1-(1-ethylpyrrolidin-1-ium-1-yl)cyclobutanecarbonyl]amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 158469422 |
| Molecular Formula | C21H30ClN2O3+ |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | ethyl 5-chloro-2-[[1-(1-ethylpyrrolidin-1-ium-1-yl)cyclobutanecarbonyl]amino]-3-methylbenzoate |
| SMILES | CCOC(=O)c1cc(Cl)cc(C)c1NC(=O)C1([N+]2(CC)CCCC2)CCC1 |
| InChI | InChI=1S/C21H29ClN2O3/c1-4-24(11-6-7-12-24)21(9-8-10-21)20(26)23-18-15(3)13-16(22)14-17(18)19(25)27-5-2/h13-14H,4-12H2,1-3H3/p+1 |
| InChIKey | ZTACUIMTPXPDMH-UHFFFAOYSA-O |
| XLogP | 4.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|