C28H34ClN2O5+ — CID 170269528
methyl 5-chloro-3-methyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)piperidin-1-ium-1-yl]cyclobutanecarbonyl]amino]benzoate (PubChem CID 170269528) has the molecular formula C28H34ClN2O5+ and a molecular weight of 514.04 g/mol. Its IUPAC name is methyl 5-chloro-3-methyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)piperidin-1-ium-1-yl]cyclobutanecarbonyl]amino]benzoate.
| Compound Name | methyl 5-chloro-3-methyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)piperidin-1-ium-1-yl]cyclobutanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 170269528 |
| Molecular Formula | C28H34ClN2O5+ |
| Molecular Weight | 514.04 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | methyl 5-chloro-3-methyl-2-[[1-[1-(2-oxo-2-phenylmethoxyethyl)piperidin-1-ium-1-yl]cyclobutanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1cc(Cl)cc(C)c1NC(=O)C1([N+]2(CC(=O)OCc3ccccc3)CCCCC2)CCC1 |
| InChI | InChI=1S/C28H33ClN2O5/c1-20-16-22(29)17-23(26(33)35-2)25(20)30-27(34)28(12-9-13-28)31(14-7-4-8-15-31)18-24(32)36-19-21-10-5-3-6-11-21/h3,5-6,10-11,16-17H,4,7-9,12-15,18-19H2,1-2H3/p+1 |
| InChIKey | ZYCFWUYVICCGCZ-UHFFFAOYSA-O |
| XLogP | 5.04 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.04 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|