C18H24ClN2O3+ — CID 155693085
methyl 5-chloro-3-methyl-2-[[1-(1-methylpyrrolidin-1-ium-1-yl)cyclopropanecarbonyl]amino]benzoate (PubChem CID 155693085) has the molecular formula C18H24ClN2O3+ and a molecular weight of 351.85 g/mol. Its IUPAC name is methyl 5-chloro-3-methyl-2-[[1-(1-methylpyrrolidin-1-ium-1-yl)cyclopropanecarbonyl]amino]benzoate.
| Compound Name | methyl 5-chloro-3-methyl-2-[[1-(1-methylpyrrolidin-1-ium-1-yl)cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 155693085 |
| Molecular Formula | C18H24ClN2O3+ |
| Molecular Weight | 351.85 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | methyl 5-chloro-3-methyl-2-[[1-(1-methylpyrrolidin-1-ium-1-yl)cyclopropanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1cc(Cl)cc(C)c1NC(=O)C1([N+]2(C)CCCC2)CC1 |
| InChI | InChI=1S/C18H23ClN2O3/c1-12-10-13(19)11-14(16(22)24-3)15(12)20-17(23)18(6-7-18)21(2)8-4-5-9-21/h10-11H,4-9H2,1-3H3/p+1 |
| InChIKey | WCTNVBCUEICGNL-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|