C19H28ClN2O3+ — CID 155692825
ethyl 5-chloro-3-methyl-2-[2-(1-methylpyrrolidin-1-ium-1-yl)butanoylamino]benzoate (PubChem CID 155692825) has the molecular formula C19H28ClN2O3+ and a molecular weight of 367.90 g/mol. Its IUPAC name is ethyl 5-chloro-3-methyl-2-[2-(1-methylpyrrolidin-1-ium-1-yl)butanoylamino]benzoate.
| Compound Name | ethyl 5-chloro-3-methyl-2-[2-(1-methylpyrrolidin-1-ium-1-yl)butanoylamino]benzoate |
|---|---|
| PubChem CID | 155692825 |
| Molecular Formula | C19H28ClN2O3+ |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | ethyl 5-chloro-3-methyl-2-[2-(1-methylpyrrolidin-1-ium-1-yl)butanoylamino]benzoate |
| SMILES | CCOC(=O)c1cc(Cl)cc(C)c1NC(=O)C(CC)[N+]1(C)CCCC1 |
| InChI | InChI=1S/C19H27ClN2O3/c1-5-16(22(4)9-7-8-10-22)18(23)21-17-13(3)11-14(20)12-15(17)19(24)25-6-2/h11-12,16H,5-10H2,1-4H3/p+1 |
| InChIKey | XRYROJHEVAXRPV-UHFFFAOYSA-O |
| XLogP | 3.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|