C17H25ClN2O3SY — CID 155692841
[1-(4-chloro-2-ethoxycarbonyl-6-methylanilino)-1-oxopentan-2-yl]-dimethyl-sulfidoazanium;yttrium (PubChem CID 155692841) has the molecular formula C17H25ClN2O3SY and a molecular weight of 461.82 g/mol. Its IUPAC name is [1-(4-chloro-2-ethoxycarbonyl-6-methylanilino)-1-oxopentan-2-yl]-dimethyl-sulfidoazanium;yttrium.
| Compound Name | [1-(4-chloro-2-ethoxycarbonyl-6-methylanilino)-1-oxopentan-2-yl]-dimethyl-sulfidoazanium;yttrium |
|---|---|
| PubChem CID | 155692841 |
| Molecular Formula | C17H25ClN2O3SY |
| Molecular Weight | 461.82 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | [1-(4-chloro-2-ethoxycarbonyl-6-methylanilino)-1-oxopentan-2-yl]-dimethyl-sulfidoazanium;yttrium |
| SMILES | CCCC(C(=O)Nc1c(C)cc(Cl)cc1C(=O)OCC)[N+](C)(C)[S-].[Y] |
| InChI | InChI=1S/C17H25ClN2O3S.Y/c1-6-8-14(20(4,5)24)16(21)19-15-11(3)9-12(18)10-13(15)17(22)23-7-2;/h9-10,14H,6-8H2,1-5H3,(H,19,21); |
| InChIKey | XTCAKYKSGFZIMF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|