C18H28N2O4Y — CID 155692910
ethyl 2-[2-(dimethylamino)pentanoylamino]-5-methoxy-3-methylbenzoate;yttrium (PubChem CID 155692910) has the molecular formula C18H28N2O4Y and a molecular weight of 425.34 g/mol. Its IUPAC name is ethyl 2-[2-(dimethylamino)pentanoylamino]-5-methoxy-3-methylbenzoate;yttrium.
| Compound Name | ethyl 2-[2-(dimethylamino)pentanoylamino]-5-methoxy-3-methylbenzoate;yttrium |
|---|---|
| PubChem CID | 155692910 |
| Molecular Formula | C18H28N2O4Y |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | ethyl 2-[2-(dimethylamino)pentanoylamino]-5-methoxy-3-methylbenzoate;yttrium |
| SMILES | CCCC(C(=O)Nc1c(C)cc(OC)cc1C(=O)OCC)N(C)C.[Y] |
| InChI | InChI=1S/C18H28N2O4.Y/c1-7-9-15(20(4)5)17(21)19-16-12(3)10-13(23-6)11-14(16)18(22)24-8-2;/h10-11,15H,7-9H2,1-6H3,(H,19,21); |
| InChIKey | OQKKAZUYTAKMGA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |