C17H29NO2PY+ — CID 160551693
ethyl-[1-(4-methoxy-2,6-dimethylanilino)-1-oxobutan-2-yl]-dimethylphosphanium;yttrium (PubChem CID 160551693) has the molecular formula C17H29NO2PY+ and a molecular weight of 399.30 g/mol. Its IUPAC name is ethyl-[1-(4-methoxy-2,6-dimethylanilino)-1-oxobutan-2-yl]-dimethylphosphanium;yttrium.
| Compound Name | ethyl-[1-(4-methoxy-2,6-dimethylanilino)-1-oxobutan-2-yl]-dimethylphosphanium;yttrium |
|---|---|
| PubChem CID | 160551693 |
| Molecular Formula | C17H29NO2PY+ |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | ethyl-[1-(4-methoxy-2,6-dimethylanilino)-1-oxobutan-2-yl]-dimethylphosphanium;yttrium |
| SMILES | CCC(C(=O)Nc1c(C)cc(OC)cc1C)[P+](C)(C)CC.[Y] |
| InChI | InChI=1S/C17H28NO2P.Y/c1-8-15(21(6,7)9-2)17(19)18-16-12(3)10-14(20-5)11-13(16)4;/h10-11,15H,8-9H2,1-7H3;/p+1 |
| InChIKey | MYRYAQLVQNERQH-UHFFFAOYSA-O |
| XLogP | 4.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|