C21H35NO2P+ — CID 158002068
2-(1-ethylphosphepan-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)butanamide (PubChem CID 158002068) has the molecular formula C21H35NO2P+ and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-(1-ethylphosphepan-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)butanamide.
| Compound Name | 2-(1-ethylphosphepan-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 158002068 |
| Molecular Formula | C21H35NO2P+ |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 2-(1-ethylphosphepan-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)butanamide |
| SMILES | CCC(C(=O)Nc1c(C)cc(OC)cc1C)[P+]1(CC)CCCCCC1 |
| InChI | InChI=1S/C21H34NO2P/c1-6-19(25(7-2)12-10-8-9-11-13-25)21(23)22-20-16(3)14-18(24-5)15-17(20)4/h14-15,19H,6-13H2,1-5H3/p+1 |
| InChIKey | FKNHRRIZQOPAIK-UHFFFAOYSA-O |
| XLogP | 5.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|