C21H32N2OP+ — CID 159774782
2-(1-ethylphosphinan-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)pentanamide (PubChem CID 159774782) has the molecular formula C21H32N2OP+ and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-(1-ethylphosphinan-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)pentanamide.
| Compound Name | 2-(1-ethylphosphinan-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)pentanamide |
|---|---|
| PubChem CID | 159774782 |
| Molecular Formula | C21H32N2OP+ |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 2-(1-ethylphosphinan-1-ium-1-yl)-N-(4-isocyano-2,6-dimethylphenyl)pentanamide |
| SMILES | [C-]#[N+]c1cc(C)c(NC(=O)C(CCC)[P+]2(CC)CCCCC2)c(C)c1 |
| InChI | InChI=1S/C21H31N2OP/c1-6-11-19(25(7-2)12-9-8-10-13-25)21(24)23-20-16(3)14-18(22-5)15-17(20)4/h14-15,19H,6-13H2,1-4H3/p+1 |
| InChIKey | YWYGAIFSMCLGKX-UHFFFAOYSA-O |
| XLogP | 6.18 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|