C17H27NO — CID 11841490
2-propyl-N-(2,4,6-trimethylphenyl)pentanamide (PubChem CID 11841490) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-propyl-N-(2,4,6-trimethylphenyl)pentanamide.
| Compound Name | 2-propyl-N-(2,4,6-trimethylphenyl)pentanamide |
|---|---|
| PubChem CID | 11841490 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 2-propyl-N-(2,4,6-trimethylphenyl)pentanamide |
| SMILES | CCCC(CCC)C(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C17H27NO/c1-6-8-15(9-7-2)17(19)18-16-13(4)10-12(3)11-14(16)5/h10-11,15H,6-9H2,1-5H3,(H,18,19) |
| InChIKey | RRTNSIHTUBBZRE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |