C13H16N2O — CID 55207019
2-cyano-N-(2,4,6-trimethylphenyl)propanamide (PubChem CID 55207019) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-cyano-N-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | 2-cyano-N-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 55207019 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-cyano-N-(2,4,6-trimethylphenyl)propanamide |
| SMILES | Cc1cc(C)c(NC(=O)C(C)C#N)c(C)c1 |
| InChI | InChI=1S/C13H16N2O/c1-8-5-9(2)12(10(3)6-8)15-13(16)11(4)7-14/h5-6,11H,1-4H3,(H,15,16) |
| InChIKey | NFKPAHJSMBAQGE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |