C19H31NOP+ — CID 157122609
2-(1-ethylphosphepan-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 157122609) has the molecular formula C19H31NOP+ and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-(1-ethylphosphepan-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-(1-ethylphosphepan-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 157122609 |
| Molecular Formula | C19H31NOP+ |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 2-(1-ethylphosphepan-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CC[P+]1(CC(=O)Nc2c(C)cc(C)cc2C)CCCCCC1 |
| InChI | InChI=1S/C19H30NOP/c1-5-22(10-8-6-7-9-11-22)14-18(21)20-19-16(3)12-15(2)13-17(19)4/h12-13H,5-11,14H2,1-4H3/p+1 |
| InChIKey | UKDBANFIDKYXTO-UHFFFAOYSA-O |
| XLogP | 5.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|