C18H28FNOPY+ — CID 159170145
2-(1-ethylphosphepan-1-ium-1-yl)-N-(4-fluoro-2,6-dimethylphenyl)acetamide;yttrium (PubChem CID 159170145) has the molecular formula C18H28FNOPY+ and a molecular weight of 413.31 g/mol. Its IUPAC name is 2-(1-ethylphosphepan-1-ium-1-yl)-N-(4-fluoro-2,6-dimethylphenyl)acetamide;yttrium.
| Compound Name | 2-(1-ethylphosphepan-1-ium-1-yl)-N-(4-fluoro-2,6-dimethylphenyl)acetamide;yttrium |
|---|---|
| PubChem CID | 159170145 |
| Molecular Formula | C18H28FNOPY+ |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-(1-ethylphosphepan-1-ium-1-yl)-N-(4-fluoro-2,6-dimethylphenyl)acetamide;yttrium |
| SMILES | CC[P+]1(CC(=O)Nc2c(C)cc(F)cc2C)CCCCCC1.[Y] |
| InChI | InChI=1S/C18H27FNOP.Y/c1-4-22(9-7-5-6-8-10-22)13-17(21)20-18-14(2)11-16(19)12-15(18)3;/h11-12H,4-10,13H2,1-3H3;/p+1 |
| InChIKey | PFOULWKQHOIUOH-UHFFFAOYSA-O |
| XLogP | 4.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|