C11H14FNOY — CID 159722509
N-(4-fluoro-2,6-dimethylphenyl)propanamide;yttrium (PubChem CID 159722509) has the molecular formula C11H14FNOY and a molecular weight of 284.14 g/mol. Its IUPAC name is N-(4-fluoro-2,6-dimethylphenyl)propanamide;yttrium.
| Compound Name | N-(4-fluoro-2,6-dimethylphenyl)propanamide;yttrium |
|---|---|
| PubChem CID | 159722509 |
| Molecular Formula | C11H14FNOY |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | N-(4-fluoro-2,6-dimethylphenyl)propanamide;yttrium |
| SMILES | CCC(=O)Nc1c(C)cc(F)cc1C.[Y] |
| InChI | InChI=1S/C11H14FNO.Y/c1-4-10(14)13-11-7(2)5-9(12)6-8(11)3;/h5-6H,4H2,1-3H3,(H,13,14); |
| InChIKey | ZAJLJHCVXOVXOY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |