C16H24FNOPY+ — CID 159651489
ethyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclopropyl]-dimethylphosphanium;yttrium (PubChem CID 159651489) has the molecular formula C16H24FNOPY+ and a molecular weight of 385.25 g/mol. Its IUPAC name is ethyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclopropyl]-dimethylphosphanium;yttrium.
| Compound Name | ethyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclopropyl]-dimethylphosphanium;yttrium |
|---|---|
| PubChem CID | 159651489 |
| Molecular Formula | C16H24FNOPY+ |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | ethyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclopropyl]-dimethylphosphanium;yttrium |
| SMILES | CC[P+](C)(C)C1(C(=O)Nc2c(C)cc(F)cc2C)CC1.[Y] |
| InChI | InChI=1S/C16H23FNOP.Y/c1-6-20(4,5)16(7-8-16)15(19)18-14-11(2)9-13(17)10-12(14)3;/h9-10H,6-8H2,1-5H3;/p+1 |
| InChIKey | RUSRJAMBHKTFAV-UHFFFAOYSA-O |
| XLogP | 4.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|