C21H34FN2O+ — CID 155693230
butyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-methyl-propylazanium (PubChem CID 155693230) has the molecular formula C21H34FN2O+ and a molecular weight of 349.51 g/mol. Its IUPAC name is butyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-methyl-propylazanium.
| Compound Name | butyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-methyl-propylazanium |
|---|---|
| PubChem CID | 155693230 |
| Molecular Formula | C21H34FN2O+ |
| Molecular Weight | 349.51 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | butyl-[1-[(4-fluoro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-methyl-propylazanium |
| SMILES | CCCC[N+](C)(CCC)C1(C(=O)Nc2c(C)cc(F)cc2C)CCC1 |
| InChI | InChI=1S/C21H33FN2O/c1-6-8-13-24(5,12-7-2)21(10-9-11-21)20(25)23-19-16(3)14-18(22)15-17(19)4/h14-15H,6-13H2,1-5H3/p+1 |
| InChIKey | SMLTYQAVANNAEP-UHFFFAOYSA-O |
| XLogP | 4.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|