C28H42ClN2O+ — CID 155693199
[1-[(4-chloro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;toluene (PubChem CID 155693199) has the molecular formula C28H42ClN2O+ and a molecular weight of 458.11 g/mol. Its IUPAC name is [1-[(4-chloro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;toluene.
| Compound Name | [1-[(4-chloro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;toluene |
|---|---|
| PubChem CID | 155693199 |
| Molecular Formula | C28H42ClN2O+ |
| Molecular Weight | 458.11 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | [1-[(4-chloro-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;toluene |
| SMILES | CCCCC[N+](C)(CC)C1(C(=O)Nc2c(C)cc(Cl)cc2C)CCC1.Cc1ccccc1 |
| InChI | InChI=1S/C21H33ClN2O.C7H8/c1-6-8-9-13-24(5,7-2)21(11-10-12-21)20(25)23-19-16(3)14-18(22)15-17(19)4;1-7-5-3-2-4-6-7/h14-15H,6-13H2,1-5H3;2-6H,1H3/p+1 |
| InChIKey | JRIFZKRBCZFQGT-UHFFFAOYSA-O |
| XLogP | 7.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.11 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|