About [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane
[1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane (PubChem CID 155693172) has the molecular formula C24H40N3O+
and a molecular weight of 386.60 g/mol. Its IUPAC name is [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane.
Molecular Properties
| Compound Name | [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane |
| PubChem CID | 155693172 |
| Molecular Formula | C24H40N3O+ |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane |
| SMILES | CC.CCCCC[N+](C)(CC)C1(C(=O)Nc2c(C)cc(C#N)cc2C)CCC1 |
| InChI | InChI=1S/C22H33N3O.C2H6/c1-6-8-9-13-25(5,7-2)22(11-10-12-22)21(26)24-20-17(3)14-19(16-23)15-18(20)4;1-2/h14-15H,6-13H2,1-5H3;1-2H3/p+1 |
| InChIKey | SMPBYKUSGDXXCU-UHFFFAOYSA-O |
| XLogP | 5.72 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane?
The IUPAC name of [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane (CID 155693172) is [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane.
What is the SMILES notation for [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane?
The canonical SMILES for [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane is CC.CCCCC[N+](C)(CC)C1(C(=O)Nc2c(C)cc(C#N)cc2C)CCC1.
What is the InChIKey of [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane?
The InChIKey is SMPBYKUSGDXXCU-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H33N3O.C2H6/c1-6-8-9-13-25(5,7-2)22(11-10-12-22)21(26)24-20-17(3)14-19(16-23)15-18(20)4;1-2/h14-15H,6-13H2,1-5H3;1-2H3/p+1.
What are the key properties of [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane?
[1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane has a molecular weight of 386.60 g/mol, XLogP of 5.72, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane is sourced from PubChem (CID 155693172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).