C24H40N3O+ — CID 155693172
[1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane (PubChem CID 155693172) has the molecular formula C24H40N3O+ and a molecular weight of 386.60 g/mol. Its IUPAC name is [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane.
| Compound Name | [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane |
|---|---|
| PubChem CID | 155693172 |
| Molecular Formula | C24H40N3O+ |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclobutyl]-ethyl-methyl-pentylazanium;ethane |
| SMILES | CC.CCCCC[N+](C)(CC)C1(C(=O)Nc2c(C)cc(C#N)cc2C)CCC1 |
| InChI | InChI=1S/C22H33N3O.C2H6/c1-6-8-9-13-25(5,7-2)22(11-10-12-22)21(26)24-20-17(3)14-19(16-23)15-18(20)4;1-2/h14-15H,6-13H2,1-5H3;1-2H3/p+1 |
| InChIKey | SMPBYKUSGDXXCU-UHFFFAOYSA-O |
| XLogP | 5.72 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|