C19H28N3O+ — CID 159262724
[1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclopropyl]-triethylazanium (PubChem CID 159262724) has the molecular formula C19H28N3O+ and a molecular weight of 314.45 g/mol. Its IUPAC name is [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclopropyl]-triethylazanium.
| Compound Name | [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclopropyl]-triethylazanium |
|---|---|
| PubChem CID | 159262724 |
| Molecular Formula | C19H28N3O+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | [1-[(4-cyano-2,6-dimethylphenyl)carbamoyl]cyclopropyl]-triethylazanium |
| SMILES | CC[N+](CC)(CC)C1(C(=O)Nc2c(C)cc(C#N)cc2C)CC1 |
| InChI | InChI=1S/C19H27N3O/c1-6-22(7-2,8-3)19(9-10-19)18(23)21-17-14(4)11-16(13-20)12-15(17)5/h11-12H,6-10H2,1-5H3/p+1 |
| InChIKey | JJKARLINYODQRS-UHFFFAOYSA-O |
| XLogP | 3.52 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|