C20H32N3O+ — CID 158588528
[1-(4-cyano-2,6-dimethylanilino)-1-oxopentan-2-yl]-triethylazanium (PubChem CID 158588528) has the molecular formula C20H32N3O+ and a molecular weight of 330.50 g/mol. Its IUPAC name is [1-(4-cyano-2,6-dimethylanilino)-1-oxopentan-2-yl]-triethylazanium.
| Compound Name | [1-(4-cyano-2,6-dimethylanilino)-1-oxopentan-2-yl]-triethylazanium |
|---|---|
| PubChem CID | 158588528 |
| Molecular Formula | C20H32N3O+ |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | [1-(4-cyano-2,6-dimethylanilino)-1-oxopentan-2-yl]-triethylazanium |
| SMILES | CCCC(C(=O)Nc1c(C)cc(C#N)cc1C)[N+](CC)(CC)CC |
| InChI | InChI=1S/C20H31N3O/c1-7-11-18(23(8-2,9-3)10-4)20(24)22-19-15(5)12-17(14-21)13-16(19)6/h12-13,18H,7-11H2,1-6H3/p+1 |
| InChIKey | WKGCDYXAFRBOLJ-UHFFFAOYSA-O |
| XLogP | 4.16 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|