C20H35N2O2+ — CID 160866649
triethyl-[1-(4-methoxy-2,6-dimethylanilino)-1-oxopentan-2-yl]azanium (PubChem CID 160866649) has the molecular formula C20H35N2O2+ and a molecular weight of 335.51 g/mol. Its IUPAC name is triethyl-[1-(4-methoxy-2,6-dimethylanilino)-1-oxopentan-2-yl]azanium.
| Compound Name | triethyl-[1-(4-methoxy-2,6-dimethylanilino)-1-oxopentan-2-yl]azanium |
|---|---|
| PubChem CID | 160866649 |
| Molecular Formula | C20H35N2O2+ |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.27 |
| IUPAC Name | triethyl-[1-(4-methoxy-2,6-dimethylanilino)-1-oxopentan-2-yl]azanium |
| SMILES | CCCC(C(=O)Nc1c(C)cc(OC)cc1C)[N+](CC)(CC)CC |
| InChI | InChI=1S/C20H34N2O2/c1-8-12-18(22(9-2,10-3)11-4)20(23)21-19-15(5)13-17(24-7)14-16(19)6/h13-14,18H,8-12H2,1-7H3/p+1 |
| InChIKey | XXYLZLKVCSYIKF-UHFFFAOYSA-O |
| XLogP | 4.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|