C23H41NO2PY+ — CID 157204933
tributyl-[2-(4-methoxy-2,6-dimethylanilino)-2-oxoethyl]phosphanium;yttrium (PubChem CID 157204933) has the molecular formula C23H41NO2PY+ and a molecular weight of 483.47 g/mol. Its IUPAC name is tributyl-[2-(4-methoxy-2,6-dimethylanilino)-2-oxoethyl]phosphanium;yttrium.
| Compound Name | tributyl-[2-(4-methoxy-2,6-dimethylanilino)-2-oxoethyl]phosphanium;yttrium |
|---|---|
| PubChem CID | 157204933 |
| Molecular Formula | C23H41NO2PY+ |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | tributyl-[2-(4-methoxy-2,6-dimethylanilino)-2-oxoethyl]phosphanium;yttrium |
| SMILES | CCCC[P+](CCCC)(CCCC)CC(=O)Nc1c(C)cc(OC)cc1C.[Y] |
| InChI | InChI=1S/C23H40NO2P.Y/c1-7-10-13-27(14-11-8-2,15-12-9-3)18-22(25)24-23-19(4)16-21(26-6)17-20(23)5;/h16-17H,7-15,18H2,1-6H3;/p+1 |
| InChIKey | LQNTUQMWIVZQEH-UHFFFAOYSA-O |
| XLogP | 6.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|