C16H25NO2P+ — CID 156737700
N-(4-methoxy-2,6-dimethylphenyl)-2-(1-methylphospholan-1-ium-1-yl)acetamide (PubChem CID 156737700) has the molecular formula C16H25NO2P+ and a molecular weight of 294.36 g/mol. Its IUPAC name is N-(4-methoxy-2,6-dimethylphenyl)-2-(1-methylphospholan-1-ium-1-yl)acetamide.
| Compound Name | N-(4-methoxy-2,6-dimethylphenyl)-2-(1-methylphospholan-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 156737700 |
| Molecular Formula | C16H25NO2P+ |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-(4-methoxy-2,6-dimethylphenyl)-2-(1-methylphospholan-1-ium-1-yl)acetamide |
| SMILES | COc1cc(C)c(NC(=O)C[P+]2(C)CCCC2)c(C)c1 |
| InChI | InChI=1S/C16H24NO2P/c1-12-9-14(19-3)10-13(2)16(12)17-15(18)11-20(4)7-5-6-8-20/h9-10H,5-8,11H2,1-4H3/p+1 |
| InChIKey | OVNPLFYAGSTTOR-UHFFFAOYSA-O |
| XLogP | 3.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|