C16H22N2OP+ — CID 156737733
N-(4-cyano-2,6-dimethylphenyl)-2-(1-methylphospholan-1-ium-1-yl)acetamide (PubChem CID 156737733) has the molecular formula C16H22N2OP+ and a molecular weight of 289.34 g/mol. Its IUPAC name is N-(4-cyano-2,6-dimethylphenyl)-2-(1-methylphospholan-1-ium-1-yl)acetamide.
| Compound Name | N-(4-cyano-2,6-dimethylphenyl)-2-(1-methylphospholan-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 156737733 |
| Molecular Formula | C16H22N2OP+ |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-(4-cyano-2,6-dimethylphenyl)-2-(1-methylphospholan-1-ium-1-yl)acetamide |
| SMILES | Cc1cc(C#N)cc(C)c1NC(=O)C[P+]1(C)CCCC1 |
| InChI | InChI=1S/C16H21N2OP/c1-12-8-14(10-17)9-13(2)16(12)18-15(19)11-20(3)6-4-5-7-20/h8-9H,4-7,11H2,1-3H3/p+1 |
| InChIKey | NFYNULLOBHSQBS-UHFFFAOYSA-O |
| XLogP | 3.55 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|