C18H26N2OP+ — CID 156737793
N-(4-cyano-2,6-dimethylphenyl)-2-(1-methylphospholan-1-ium-1-yl)butanamide (PubChem CID 156737793) has the molecular formula C18H26N2OP+ and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(4-cyano-2,6-dimethylphenyl)-2-(1-methylphospholan-1-ium-1-yl)butanamide.
| Compound Name | N-(4-cyano-2,6-dimethylphenyl)-2-(1-methylphospholan-1-ium-1-yl)butanamide |
|---|---|
| PubChem CID | 156737793 |
| Molecular Formula | C18H26N2OP+ |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | N-(4-cyano-2,6-dimethylphenyl)-2-(1-methylphospholan-1-ium-1-yl)butanamide |
| SMILES | CCC(C(=O)Nc1c(C)cc(C#N)cc1C)[P+]1(C)CCCC1 |
| InChI | InChI=1S/C18H25N2OP/c1-5-16(22(4)8-6-7-9-22)18(21)20-17-13(2)10-15(12-19)11-14(17)3/h10-11,16H,5-9H2,1-4H3/p+1 |
| InChIKey | JSLWIPZJYTZTDR-UHFFFAOYSA-O |
| XLogP | 4.33 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|