C20H33NOPY+ — CID 161486197
N-(2,6-dimethylphenyl)-2-(1-ethylphosphepan-1-ium-1-yl)butanamide;yttrium (PubChem CID 161486197) has the molecular formula C20H33NOPY+ and a molecular weight of 423.37 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-(1-ethylphosphepan-1-ium-1-yl)butanamide;yttrium.
| Compound Name | N-(2,6-dimethylphenyl)-2-(1-ethylphosphepan-1-ium-1-yl)butanamide;yttrium |
|---|---|
| PubChem CID | 161486197 |
| Molecular Formula | C20H33NOPY+ |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-(1-ethylphosphepan-1-ium-1-yl)butanamide;yttrium |
| SMILES | CCC(C(=O)Nc1c(C)cccc1C)[P+]1(CC)CCCCCC1.[Y] |
| InChI | InChI=1S/C20H32NOP.Y/c1-5-18(23(6-2)14-9-7-8-10-15-23)20(22)21-19-16(3)12-11-13-17(19)4;/h11-13,18H,5-10,14-15H2,1-4H3;/p+1 |
| InChIKey | CAPKSGOYOSUOPC-UHFFFAOYSA-O |
| XLogP | 5.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|