C15H24NOPSY — CID 156737684
[1-(2,6-dimethylanilino)-1-oxopentan-2-yl]-dimethyl-sulfidophosphanium;yttrium (PubChem CID 156737684) has the molecular formula C15H24NOPSY and a molecular weight of 386.31 g/mol. Its IUPAC name is [1-(2,6-dimethylanilino)-1-oxopentan-2-yl]-dimethyl-sulfidophosphanium;yttrium.
| Compound Name | [1-(2,6-dimethylanilino)-1-oxopentan-2-yl]-dimethyl-sulfidophosphanium;yttrium |
|---|---|
| PubChem CID | 156737684 |
| Molecular Formula | C15H24NOPSY |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | [1-(2,6-dimethylanilino)-1-oxopentan-2-yl]-dimethyl-sulfidophosphanium;yttrium |
| SMILES | CCCC(C(=O)Nc1c(C)cccc1C)[P+](C)(C)[S-].[Y] |
| InChI | InChI=1S/C15H24NOPS.Y/c1-6-8-13(18(4,5)19)15(17)16-14-11(2)9-7-10-12(14)3;/h7,9-10,13H,6,8H2,1-5H3,(H,16,17); |
| InChIKey | ZYIVKLNFSWMRFE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|